About N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine
N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine (PubChem CID 70458967) has the molecular formula C6H12N4S
and a molecular weight of 172.26 g/mol. Its IUPAC name is N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine |
| PubChem CID | 70458967 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine |
| SMILES | CC(NCCN)c1cnns1 |
| InChI | InChI=1S/C6H12N4S/c1-5(8-3-2-7)6-4-9-10-11-6/h4-5,8H,2-3,7H2,1H3 |
| InChIKey | ROTXYWZRHUYEIV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine?
The IUPAC name of N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine (CID 70458967) is N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine?
The canonical SMILES for N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine is CC(NCCN)c1cnns1.
What is the InChIKey of N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine?
The InChIKey is ROTXYWZRHUYEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S/c1-5(8-3-2-7)6-4-9-10-11-6/h4-5,8H,2-3,7H2,1H3.
What are the key properties of N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine?
N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine has a molecular weight of 172.26 g/mol, XLogP of 0.15, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(thiadiazol-5-yl)ethyl]ethane-1,2-diamine is sourced from PubChem (CID 70458967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).