C26H30N2O4 — CID 70459087
methyl 7-[4-(1H-imidazol-2-yl)phenyl]-7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)heptanoate (PubChem CID 70459087) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is methyl 7-[4-(1H-imidazol-2-yl)phenyl]-7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)heptanoate.
| Compound Name | methyl 7-[4-(1H-imidazol-2-yl)phenyl]-7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)heptanoate |
|---|---|
| PubChem CID | 70459087 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl 7-[4-(1H-imidazol-2-yl)phenyl]-7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)heptanoate |
| SMILES | COC(=O)CCCCCC(C1=C(C)C(=O)C(C)=C(C)C1=O)c1ccc(-c2ncc[nH]2)cc1 |
| InChI | InChI=1S/C26H30N2O4/c1-16-17(2)25(31)23(18(3)24(16)30)21(8-6-5-7-9-22(29)32-4)19-10-12-20(13-11-19)26-27-14-15-28-26/h10-15,21H,5-9H2,1-4H3,(H,27,28) |
| InChIKey | SFVQHHMTGRQSTQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|