C20H29N3O — CID 70459117
1-[3,3-dimethyl-2-[5-(2-methylphenyl)pentoxy]but-1-enyl]-1,2,4-triazole (PubChem CID 70459117) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-[5-(2-methylphenyl)pentoxy]but-1-enyl]-1,2,4-triazole.
| Compound Name | 1-[3,3-dimethyl-2-[5-(2-methylphenyl)pentoxy]but-1-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 70459117 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 1-[3,3-dimethyl-2-[5-(2-methylphenyl)pentoxy]but-1-enyl]-1,2,4-triazole |
| SMILES | Cc1ccccc1CCCCCOC(=Cn1cncn1)C(C)(C)C |
| InChI | InChI=1S/C20H29N3O/c1-17-10-7-8-12-18(17)11-6-5-9-13-24-19(20(2,3)4)14-23-16-21-15-22-23/h7-8,10,12,14-16H,5-6,9,11,13H2,1-4H3 |
| InChIKey | HZMXOAPLBUZPFH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|