C22H31NO — CID 70459659
5-[(E)-2-(3-ethyl-3,5,5,8-tetramethyl-2,6,7,8-tetrahydronaphthalen-2-yl)prop-1-enyl]-1,2-oxazole (PubChem CID 70459659) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 5-[(E)-2-(3-ethyl-3,5,5,8-tetramethyl-2,6,7,8-tetrahydronaphthalen-2-yl)prop-1-enyl]-1,2-oxazole.
| Compound Name | 5-[(E)-2-(3-ethyl-3,5,5,8-tetramethyl-2,6,7,8-tetrahydronaphthalen-2-yl)prop-1-enyl]-1,2-oxazole |
|---|---|
| PubChem CID | 70459659 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 5-[(E)-2-(3-ethyl-3,5,5,8-tetramethyl-2,6,7,8-tetrahydronaphthalen-2-yl)prop-1-enyl]-1,2-oxazole |
| SMILES | CCC1(C)C=C2C(=CC1/C(C)=C/c1ccno1)C(C)CCC2(C)C |
| InChI | InChI=1S/C22H31NO/c1-7-22(6)14-20-18(15(2)8-10-21(20,4)5)13-19(22)16(3)12-17-9-11-23-24-17/h9,11-15,19H,7-8,10H2,1-6H3/b16-12+ |
| InChIKey | ZTPYIAWSAVMBCK-FOWTUZBSSA-N |
| XLogP | 6.43 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |