C24H32N2O5 — CID 70459768
[5-[(E)-2-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]-1,2-oxazol-3-yl] N-(2,3-dihydroxypropyl)carbamate (PubChem CID 70459768) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is [5-[(E)-2-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]-1,2-oxazol-3-yl] N-(2,3-dihydroxypropyl)carbamate.
| Compound Name | [5-[(E)-2-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]-1,2-oxazol-3-yl] N-(2,3-dihydroxypropyl)carbamate |
|---|---|
| PubChem CID | 70459768 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [5-[(E)-2-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]-1,2-oxazol-3-yl] N-(2,3-dihydroxypropyl)carbamate |
| SMILES | C/C(=C\c1cc(OC(=O)NCC(O)CO)no1)c1ccc2c(c1)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C24H32N2O5/c1-14(9-18-11-21(26-31-18)30-22(29)25-12-17(28)13-27)16-7-8-19-20(10-16)24(5,6)15(2)23(19,3)4/h7-11,15,17,27-28H,12-13H2,1-6H3,(H,25,29)/b14-9+ |
| InChIKey | NAFBKFMJXOMMAQ-NTEUORMPSA-N |
| XLogP | 3.88 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |