About 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one
2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one (PubChem CID 70459800) has the molecular formula C6H5ClN2O3
and a molecular weight of 188.57 g/mol. Its IUPAC name is 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one |
| PubChem CID | 70459800 |
| Molecular Formula | C6H5ClN2O3 |
| Molecular Weight | 188.57 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one |
| SMILES | NC1=CC([N+](=O)[O-])=CC(Cl)C1=O |
| InChI | InChI=1S/C6H5ClN2O3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,4H,8H2 |
| InChIKey | QUAIGNBEBFHYJF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.57 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one?
The IUPAC name of 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one (CID 70459800) is 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one?
The canonical SMILES for 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one is NC1=CC([N+](=O)[O-])=CC(Cl)C1=O.
What is the InChIKey of 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one?
The InChIKey is QUAIGNBEBFHYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN2O3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,4H,8H2.
What are the key properties of 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one?
2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one has a molecular weight of 188.57 g/mol, XLogP of 0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-chloro-4-nitrocyclohexa-2,4-dien-1-one is sourced from PubChem (CID 70459800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).