About methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate
methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate (PubChem CID 70459867) has the molecular formula C14H27NO5
and a molecular weight of 289.37 g/mol. Its IUPAC name is methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate |
| PubChem CID | 70459867 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CN(CCCC(OC)OC)CC[C@H]1OC |
| InChI | InChI=1S/C14H27NO5/c1-17-12-7-9-15(10-11(12)14(16)20-4)8-5-6-13(18-2)19-3/h11-13H,5-10H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | AXWAODXKSYLESE-NWDGAFQWSA-N |
| XLogP | 0.90 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate?
The IUPAC name of methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate (CID 70459867) is methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate.
What is the SMILES notation for methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate?
The canonical SMILES for methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate is COC(=O)[C@H]1CN(CCCC(OC)OC)CC[C@H]1OC.
What is the InChIKey of methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate?
The InChIKey is AXWAODXKSYLESE-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H27NO5/c1-17-12-7-9-15(10-11(12)14(16)20-4)8-5-6-13(18-2)19-3/h11-13H,5-10H2,1-4H3/t11-,12+/m0/s1.
What are the key properties of methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate?
methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate has a molecular weight of 289.37 g/mol, XLogP of 0.90, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,4R)-1-(4,4-dimethoxybutyl)-4-methoxypiperidine-3-carboxylate is sourced from PubChem (CID 70459867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).