About 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine
2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine (PubChem CID 70460645) has the molecular formula C11H17N3S
and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine |
| PubChem CID | 70460645 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine |
| SMILES | CCSC1Nc2ccccc2N1N(C)C |
| InChI | InChI=1S/C11H17N3S/c1-4-15-11-12-9-7-5-6-8-10(9)14(11)13(2)3/h5-8,11-12H,4H2,1-3H3 |
| InChIKey | ARMMAUMIDFLTBQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine?
The IUPAC name of 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine (CID 70460645) is 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine.
What is the SMILES notation for 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine?
The canonical SMILES for 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine is CCSC1Nc2ccccc2N1N(C)C.
What is the InChIKey of 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine?
The InChIKey is ARMMAUMIDFLTBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3S/c1-4-15-11-12-9-7-5-6-8-10(9)14(11)13(2)3/h5-8,11-12H,4H2,1-3H3.
What are the key properties of 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine?
2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine has a molecular weight of 223.34 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-N,N-dimethyl-2,3-dihydrobenzimidazol-1-amine is sourced from PubChem (CID 70460645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).