C20H25N5O3 — CID 70460871
9-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]-6-phenylmethoxypurin-2-amine (PubChem CID 70460871) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 9-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]-6-phenylmethoxypurin-2-amine.
| Compound Name | 9-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]-6-phenylmethoxypurin-2-amine |
|---|---|
| PubChem CID | 70460871 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 9-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]-6-phenylmethoxypurin-2-amine |
| SMILES | CCC(C1COC(C)(C)O1)n1cnc2c(OCc3ccccc3)nc(N)nc21 |
| InChI | InChI=1S/C20H25N5O3/c1-4-14(15-11-27-20(2,3)28-15)25-12-22-16-17(25)23-19(21)24-18(16)26-10-13-8-6-5-7-9-13/h5-9,12,14-15H,4,10-11H2,1-3H3,(H2,21,23,24) |
| InChIKey | CXFQQMDGAPYXMO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |