C27H32N6O6 — CID 70460906
but-2-enedioic acid;7-[3-[4-(1H-indol-3-yl)piperidin-1-yl]propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 70460906) has the molecular formula C27H32N6O6 and a molecular weight of 536.59 g/mol. Its IUPAC name is but-2-enedioic acid;7-[3-[4-(1H-indol-3-yl)piperidin-1-yl]propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | but-2-enedioic acid;7-[3-[4-(1H-indol-3-yl)piperidin-1-yl]propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70460906 |
| Molecular Formula | C27H32N6O6 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | but-2-enedioic acid;7-[3-[4-(1H-indol-3-yl)piperidin-1-yl]propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCCN2CCC(c3c[nH]c4ccccc34)CC2)n(C)c1=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H28N6O2.C4H4O4/c1-26-21-20(22(30)27(2)23(26)31)29(15-25-21)11-5-10-28-12-8-16(9-13-28)18-14-24-19-7-4-3-6-17(18)19;5-3(6)1-2-4(7)8/h3-4,6-7,14-16,24H,5,8-13H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | MCLQSYRZFPRXCA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 155.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|