C17H19N — CID 70461251
(1R,9R,10R)-13-methylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraene (PubChem CID 70461251) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is (1R,9R,10R)-13-methylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraene.
| Compound Name | (1R,9R,10R)-13-methylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraene |
|---|---|
| PubChem CID | 70461251 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (1R,9R,10R)-13-methylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraene |
| SMILES | C=C1C=C[C@H]2[C@H]3Cc4ccccc4[C@@]2(CCN3)C1 |
| InChI | InChI=1S/C17H19N/c1-12-6-7-15-16-10-13-4-2-3-5-14(13)17(15,11-12)8-9-18-16/h2-7,15-16,18H,1,8-11H2/t15-,16+,17+/m0/s1 |
| InChIKey | IMQSWZUDJJYRJL-GVDBMIGSSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |