C15H15Cl2FN2O2 — CID 70461309
3-chloro-2-[4-chloro-2-fluoro-5-(methoxymethoxy)phenyl]-4,5,6,7-tetrahydroindazole (PubChem CID 70461309) has the molecular formula C15H15Cl2FN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 3-chloro-2-[4-chloro-2-fluoro-5-(methoxymethoxy)phenyl]-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-chloro-2-[4-chloro-2-fluoro-5-(methoxymethoxy)phenyl]-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 70461309 |
| Molecular Formula | C15H15Cl2FN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 3-chloro-2-[4-chloro-2-fluoro-5-(methoxymethoxy)phenyl]-4,5,6,7-tetrahydroindazole |
| SMILES | COCOc1cc(-n2nc3c(c2Cl)CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C15H15Cl2FN2O2/c1-21-8-22-14-7-13(11(18)6-10(14)16)20-15(17)9-4-2-3-5-12(9)19-20/h6-7H,2-5,8H2,1H3 |
| InChIKey | BFRBXHAKNWOVHW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|