C7H4N2O2 — CID 70461504
3H-pyrrolo[3,4-b]pyridine-2,5-dione (PubChem CID 70461504) has the molecular formula C7H4N2O2 and a molecular weight of 148.12 g/mol. Its IUPAC name is 3H-pyrrolo[3,4-b]pyridine-2,5-dione.
| Compound Name | 3H-pyrrolo[3,4-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 70461504 |
| Molecular Formula | C7H4N2O2 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 3H-pyrrolo[3,4-b]pyridine-2,5-dione |
| SMILES | O=C1CC=C2C(=O)N=CC2=N1 |
| InChI | InChI=1S/C7H4N2O2/c10-6-2-1-4-5(9-6)3-8-7(4)11/h1,3H,2H2 |
| InChIKey | FMJTYTMJIDCRPD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |