About 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one
4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 70461735) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one |
| PubChem CID | 70461735 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | NC1(C=C2C(=O)ON=C2c2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C16H14N2O2/c17-16(9-5-2-6-10-16)11-13-14(18-20-15(13)19)12-7-3-1-4-8-12/h1-9,11H,10,17H2 |
| InChIKey | PJQCGFOQLSJLNO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The IUPAC name of 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one (CID 70461735) is 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one.
What is the SMILES notation for 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The canonical SMILES for 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one is NC1(C=C2C(=O)ON=C2c2ccccc2)C=CC=CC1.
What is the InChIKey of 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The InChIKey is PJQCGFOQLSJLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c17-16(9-5-2-6-10-16)11-13-14(18-20-15(13)19)12-7-3-1-4-8-12/h1-9,11H,10,17H2.
What are the key properties of 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one?
4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one has a molecular weight of 266.30 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-aminocyclohexa-2,4-dien-1-yl)methylidene]-3-phenyl-1,2-oxazol-5-one is sourced from PubChem (CID 70461735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).