C17H14Cl2FN3 — CID 70461758
4-[1,1-bis(4-chlorophenyl)-1-fluoropropan-2-yl]-2H-triazole (PubChem CID 70461758) has the molecular formula C17H14Cl2FN3 and a molecular weight of 350.22 g/mol. Its IUPAC name is 4-[1,1-bis(4-chlorophenyl)-1-fluoropropan-2-yl]-2H-triazole.
| Compound Name | 4-[1,1-bis(4-chlorophenyl)-1-fluoropropan-2-yl]-2H-triazole |
|---|---|
| PubChem CID | 70461758 |
| Molecular Formula | C17H14Cl2FN3 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-[1,1-bis(4-chlorophenyl)-1-fluoropropan-2-yl]-2H-triazole |
| SMILES | CC(c1cn[nH]n1)C(F)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2FN3/c1-11(16-10-21-23-22-16)17(20,12-2-6-14(18)7-3-12)13-4-8-15(19)9-5-13/h2-11H,1H3,(H,21,22,23) |
| InChIKey | QSNUOYBURRSQBY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |