C28H44O2 — CID 70461852
3,5-ditert-butylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 70461852) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 3,5-ditert-butylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 3,5-ditert-butylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 70461852 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 3,5-ditert-butylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)cc1.CC(C)(C)c1cc(O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/2C14H22O/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10;1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11/h7-9,15H,1-6H3;6-9,15H,10H2,1-5H3 |
| InChIKey | HUIJQVWRBAXCJQ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |