C25H24ClNO5 — CID 70462217
7-(butylaminomethyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydrochloride (PubChem CID 70462217) has the molecular formula C25H24ClNO5 and a molecular weight of 453.92 g/mol. Its IUPAC name is 7-(butylaminomethyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydrochloride.
| Compound Name | 7-(butylaminomethyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydrochloride |
|---|---|
| PubChem CID | 70462217 |
| Molecular Formula | C25H24ClNO5 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 7-(butylaminomethyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydrochloride |
| SMILES | CCCCNCc1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21.Cl |
| InChI | InChI=1S/C25H23NO5.ClH/c1-2-3-11-26-14-15-5-4-6-20-23(15)24(29)31-25(20)18-9-7-16(27)12-21(18)30-22-13-17(28)8-10-19(22)25;/h4-10,12-13,26-28H,2-3,11,14H2,1H3;1H |
| InChIKey | BFTVEDYRIQJJNK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|