About cuban-1-ylmercury
cuban-1-ylmercury (PubChem CID 70462284) has the molecular formula C8H7Hg
and a molecular weight of 303.73 g/mol. Its IUPAC name is cuban-1-ylmercury.
Molecular Properties
| Compound Name | cuban-1-ylmercury |
| PubChem CID | 70462284 |
| Molecular Formula | C8H7Hg |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | cuban-1-ylmercury |
| SMILES | [Hg]C12C3C4C5C3C1C5C42 |
| InChI | InChI=1S/C8H7.Hg/c1-2-5-3(1)7-4(1)6(2)8(5)7;/h1-7H; |
| InChIKey | GMXGGEWRNFUWDW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cuban-1-ylmercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cuban-1-ylmercury?
The IUPAC name of cuban-1-ylmercury (CID 70462284) is cuban-1-ylmercury.
What is the SMILES notation for cuban-1-ylmercury?
The canonical SMILES for cuban-1-ylmercury is [Hg]C12C3C4C5C3C1C5C42.
What is the InChIKey of cuban-1-ylmercury?
The InChIKey is GMXGGEWRNFUWDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7.Hg/c1-2-5-3(1)7-4(1)6(2)8(5)7;/h1-7H;.
What are the key properties of cuban-1-ylmercury?
cuban-1-ylmercury has a molecular weight of 303.73 g/mol, XLogP of 1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cuban-1-ylmercury is sourced from PubChem (CID 70462284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).