C10H13N3O2 — CID 70462394
5-hydroxy-1-[(5-methyl-2-pyridinyl)methyl]imidazolidin-2-one (PubChem CID 70462394) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-hydroxy-1-[(5-methyl-2-pyridinyl)methyl]imidazolidin-2-one.
| Compound Name | 5-hydroxy-1-[(5-methyl-2-pyridinyl)methyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 70462394 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 5-hydroxy-1-[(5-methyl-2-pyridinyl)methyl]imidazolidin-2-one |
| SMILES | Cc1ccc(CN2C(=O)NCC2O)nc1 |
| InChI | InChI=1S/C10H13N3O2/c1-7-2-3-8(11-4-7)6-13-9(14)5-12-10(13)15/h2-4,9,14H,5-6H2,1H3,(H,12,15) |
| InChIKey | MAWUUMMCBRHZNU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |