About 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole
4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole (PubChem CID 70462961) has the molecular formula C19H16F5N3O2
and a molecular weight of 413.35 g/mol. Its IUPAC name is 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole.
Molecular Properties
| Compound Name | 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole |
| PubChem CID | 70462961 |
| Molecular Formula | C19H16F5N3O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole |
| SMILES | CC(c1cn[nH]n1)C(F)(c1ccc(OC(F)F)cc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H16F5N3O2/c1-11(16-10-25-27-26-16)19(24,12-2-6-14(7-3-12)28-17(20)21)13-4-8-15(9-5-13)29-18(22)23/h2-11,17-18H,1H3,(H,25,26,27) |
| InChIKey | OBNBXYILIMAPMP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole?
The IUPAC name of 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole (CID 70462961) is 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole.
What is the SMILES notation for 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole?
The canonical SMILES for 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole is CC(c1cn[nH]n1)C(F)(c1ccc(OC(F)F)cc1)c1ccc(OC(F)F)cc1.
What is the InChIKey of 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole?
The InChIKey is OBNBXYILIMAPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F5N3O2/c1-11(16-10-25-27-26-16)19(24,12-2-6-14(7-3-12)28-17(20)21)13-4-8-15(9-5-13)29-18(22)23/h2-11,17-18H,1H3,(H,25,26,27).
What are the key properties of 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole?
4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole has a molecular weight of 413.35 g/mol, XLogP of 5.02, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,1-bis[4-(difluoromethoxy)phenyl]-1-fluoropropan-2-yl]-2H-triazole is sourced from PubChem (CID 70462961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).