C20H23NO — CID 70463034
5-(4-methoxyphenyl)-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]isoquinoline (PubChem CID 70463034) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]isoquinoline.
| Compound Name | 5-(4-methoxyphenyl)-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]isoquinoline |
|---|---|
| PubChem CID | 70463034 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 5-(4-methoxyphenyl)-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]isoquinoline |
| SMILES | COc1ccc(C2Cc3ccccc3C3CNCCC23)cc1 |
| InChI | InChI=1S/C20H23NO/c1-22-16-8-6-14(7-9-16)19-12-15-4-2-3-5-17(15)20-13-21-11-10-18(19)20/h2-9,18-21H,10-13H2,1H3 |
| InChIKey | CQEYWCOXQNFDQC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |