C18H23F3N8O7S — CID 70463506
(Z)-but-2-enedioic acid;1-[2-[3-[2-(methanesulfonamido)imidazol-1-yl]propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 70463506) has the molecular formula C18H23F3N8O7S and a molecular weight of 552.49 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[2-[3-[2-(methanesulfonamido)imidazol-1-yl]propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | (Z)-but-2-enedioic acid;1-[2-[3-[2-(methanesulfonamido)imidazol-1-yl]propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 70463506 |
| Molecular Formula | C18H23F3N8O7S |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[2-[3-[2-(methanesulfonamido)imidazol-1-yl]propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CS(=O)(=O)Nc1nccn1CCCOc1nccc(N/C(N)=N/CC(F)(F)F)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H19F3N8O3S.C4H4O4/c1-29(26,27)24-12-19-5-7-25(12)6-2-8-28-13-20-4-3-10(23-13)22-11(18)21-9-14(15,16)17;5-3(6)1-2-4(7)8/h3-5,7H,2,6,8-9H2,1H3,(H,19,24)(H3,18,20,21,22,23);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KEHQJUHNVXVUBZ-BTJKTKAUSA-N |
| XLogP | 0.51 |
| TPSA | 224.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|