C18H23F3N8O7S — CID 70463509
(Z)-4-[2-methylsulfonylimino-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]imidazolidin-1-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 70463509) has the molecular formula C18H23F3N8O7S and a molecular weight of 552.49 g/mol. Its IUPAC name is (Z)-4-[2-methylsulfonylimino-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]imidazolidin-1-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-methylsulfonylimino-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]imidazolidin-1-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 70463509 |
| Molecular Formula | C18H23F3N8O7S |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | (Z)-4-[2-methylsulfonylimino-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]imidazolidin-1-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | CS(=O)(=O)N=C1N(CCCOc2nccc(N/C(N)=N/CC(F)(F)F)n2)CCN1OC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H23F3N8O7S/c1-37(33,34)27-17-28(8-9-29(17)36-14(32)4-3-13(30)31)7-2-10-35-16-23-6-5-12(26-16)25-15(22)24-11-18(19,20)21/h3-6H,2,7-11H2,1H3,(H,30,31)(H3,22,23,24,25,26)/b4-3-,27-17? |
| InChIKey | YJZOHFQQXFKKGP-GXQWIGKWSA-N |
| XLogP | -0.43 |
| TPSA | 202.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|