C21H33FO4 — CID 70464261
methyl (Z)-7-[(4R,5R)-5-[(E,3R)-4-fluoro-3-hydroxyoct-1-enyl]-4-hydroxycyclopenten-1-yl]hept-5-enoate (PubChem CID 70464261) has the molecular formula C21H33FO4 and a molecular weight of 368.49 g/mol. Its IUPAC name is methyl (Z)-7-[(4R,5R)-5-[(E,3R)-4-fluoro-3-hydroxyoct-1-enyl]-4-hydroxycyclopenten-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(4R,5R)-5-[(E,3R)-4-fluoro-3-hydroxyoct-1-enyl]-4-hydroxycyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 70464261 |
| Molecular Formula | C21H33FO4 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | methyl (Z)-7-[(4R,5R)-5-[(E,3R)-4-fluoro-3-hydroxyoct-1-enyl]-4-hydroxycyclopenten-1-yl]hept-5-enoate |
| SMILES | CCCCC(F)[C@H](O)/C=C/[C@@H]1C(C/C=C\CCCC(=O)OC)=CC[C@H]1O |
| InChI | InChI=1S/C21H33FO4/c1-3-4-10-18(22)20(24)15-13-17-16(12-14-19(17)23)9-7-5-6-8-11-21(25)26-2/h5,7,12-13,15,17-20,23-24H,3-4,6,8-11,14H2,1-2H3/b7-5-,15-13+/t17-,18?,19-,20-/m1/s1 |
| InChIKey | HZKWRLLYDDQLMZ-OSIPSNNZSA-N |
| XLogP | 4.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|