C10H11Cl3N2O3S — CID 70464284
2,2,2-trichloroethyl (6R)-7-amino-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate (PubChem CID 70464284) has the molecular formula C10H11Cl3N2O3S and a molecular weight of 345.64 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-7-amino-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-7-amino-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 70464284 |
| Molecular Formula | C10H11Cl3N2O3S |
| Molecular Weight | 345.64 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-7-amino-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylate |
| SMILES | CC1S[C@@H]2C(N)C(=O)N2C=C1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H11Cl3N2O3S/c1-4-5(9(17)18-3-10(11,12)13)2-15-7(16)6(14)8(15)19-4/h2,4,6,8H,3,14H2,1H3/t4?,6?,8-/m1/s1 |
| InChIKey | OUAGMOPBTMSUQK-FNEPJRLNSA-N |
| XLogP | 1.41 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.64 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|