C12H9FN2O3S — CID 70464639
(E)-4-(5-fluoro-1,1,3-trioxo-1,2-benzothiazol-2-yl)-3-methylbut-2-enenitrile (PubChem CID 70464639) has the molecular formula C12H9FN2O3S and a molecular weight of 280.28 g/mol. Its IUPAC name is (E)-4-(5-fluoro-1,1,3-trioxo-1,2-benzothiazol-2-yl)-3-methylbut-2-enenitrile.
| Compound Name | (E)-4-(5-fluoro-1,1,3-trioxo-1,2-benzothiazol-2-yl)-3-methylbut-2-enenitrile |
|---|---|
| PubChem CID | 70464639 |
| Molecular Formula | C12H9FN2O3S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | (E)-4-(5-fluoro-1,1,3-trioxo-1,2-benzothiazol-2-yl)-3-methylbut-2-enenitrile |
| SMILES | C/C(=C\C#N)CN1C(=O)c2cc(F)ccc2S1(=O)=O |
| InChI | InChI=1S/C12H9FN2O3S/c1-8(4-5-14)7-15-12(16)10-6-9(13)2-3-11(10)19(15,17)18/h2-4,6H,7H2,1H3/b8-4+ |
| InChIKey | NHJCRYWQMHGMHE-XBXARRHUSA-N |
| XLogP | 1.44 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|