C8H16N2O — CID 70464778
1-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)ethanol (PubChem CID 70464778) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)ethanol.
| Compound Name | 1-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)ethanol |
|---|---|
| PubChem CID | 70464778 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)ethanol |
| SMILES | CC(O)NC1=NCCCCC1 |
| InChI | InChI=1S/C8H16N2O/c1-7(11)10-8-5-3-2-4-6-9-8/h7,11H,2-6H2,1H3,(H,9,10) |
| InChIKey | AFDJEIMYMBPZJM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|