About hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium
hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium (PubChem CID 70465553) has the molecular formula C5H7N3O3P+
and a molecular weight of 188.10 g/mol. Its IUPAC name is hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium.
Molecular Properties
| Compound Name | hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium |
| PubChem CID | 70465553 |
| Molecular Formula | C5H7N3O3P+ |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium |
| SMILES | O=[P+](O)OCC=Cn1cncn1 |
| InChI | InChI=1S/C5H6N3O3P/c9-12(10)11-3-1-2-8-5-6-4-7-8/h1-2,4-5H,3H2/p+1 |
| InChIKey | KICKEHJNFYWYOM-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium?
The IUPAC name of hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium (CID 70465553) is hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium.
What is the SMILES notation for hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium?
The canonical SMILES for hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium is O=[P+](O)OCC=Cn1cncn1.
What is the InChIKey of hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium?
The InChIKey is KICKEHJNFYWYOM-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H6N3O3P/c9-12(10)11-3-1-2-8-5-6-4-7-8/h1-2,4-5H,3H2/p+1.
What are the key properties of hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium?
hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium has a molecular weight of 188.10 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-[3-(1,2,4-triazol-1-yl)prop-2-enoxy]phosphanium is sourced from PubChem (CID 70465553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).