About 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid
2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid (PubChem CID 70465583) has the molecular formula C10H13ClO3
and a molecular weight of 216.66 g/mol. Its IUPAC name is 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid.
Molecular Properties
| Compound Name | 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid |
| PubChem CID | 70465583 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid |
| SMILES | CC1(C)C=C(Cl)C=CC1OCC(=O)O |
| InChI | InChI=1S/C10H13ClO3/c1-10(2)5-7(11)3-4-8(10)14-6-9(12)13/h3-5,8H,6H2,1-2H3,(H,12,13) |
| InChIKey | TWTAKOGISDTSAX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The IUPAC name of 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid (CID 70465583) is 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid.
What is the SMILES notation for 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The canonical SMILES for 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid is CC1(C)C=C(Cl)C=CC1OCC(=O)O.
What is the InChIKey of 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The InChIKey is TWTAKOGISDTSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO3/c1-10(2)5-7(11)3-4-8(10)14-6-9(12)13/h3-5,8H,6H2,1-2H3,(H,12,13).
What are the key properties of 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid has a molecular weight of 216.66 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid is sourced from PubChem (CID 70465583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).