About 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate
2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate (PubChem CID 70465791) has the molecular formula C19H22FNO2
and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate.
Molecular Properties
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate |
| PubChem CID | 70465791 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate |
| SMILES | CCCNC(=O)OCCc1ccc(Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FNO2/c1-2-12-21-19(22)23-13-11-15-3-5-16(6-4-15)14-17-7-9-18(20)10-8-17/h3-10H,2,11-14H2,1H3,(H,21,22) |
| InChIKey | LTRXOZVGXWHYIL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate?
The IUPAC name of 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate (CID 70465791) is 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate.
What is the SMILES notation for 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate?
The canonical SMILES for 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate is CCCNC(=O)OCCc1ccc(Cc2ccc(F)cc2)cc1.
What is the InChIKey of 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate?
The InChIKey is LTRXOZVGXWHYIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNO2/c1-2-12-21-19(22)23-13-11-15-3-5-16(6-4-15)14-17-7-9-18(20)10-8-17/h3-10H,2,11-14H2,1H3,(H,21,22).
What are the key properties of 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate?
2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate has a molecular weight of 315.39 g/mol, XLogP of 4.10, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-fluorophenyl)methyl]phenyl]ethyl N-propylcarbamate is sourced from PubChem (CID 70465791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).