C21H17N3O5 — CID 7046624
4-[4-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenoxy]-3-nitrobenzonitrile (PubChem CID 7046624) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is 4-[4-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenoxy]-3-nitrobenzonitrile.
| Compound Name | 4-[4-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenoxy]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 7046624 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[4-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenoxy]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(N3C(=O)[C@H]4CCCC[C@H]4C3=O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17N3O5/c22-12-13-5-10-19(18(11-13)24(27)28)29-15-8-6-14(7-9-15)23-20(25)16-3-1-2-4-17(16)21(23)26/h5-11,16-17H,1-4H2/t16-,17+ |
| InChIKey | PWOLCELAAVSXLD-CALCHBBNSA-N |
| XLogP | 3.94 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|