C25H30FN2O9P — CID 70466571
[(2R,3S,5R)-5-(3-acetyl-5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 8-phenyloct-3-ynyl hydrogen phosphate (PubChem CID 70466571) has the molecular formula C25H30FN2O9P and a molecular weight of 552.49 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(3-acetyl-5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 8-phenyloct-3-ynyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(3-acetyl-5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 8-phenyloct-3-ynyl hydrogen phosphate |
|---|---|
| PubChem CID | 70466571 |
| Molecular Formula | C25H30FN2O9P |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | [(2R,3S,5R)-5-(3-acetyl-5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 8-phenyloct-3-ynyl hydrogen phosphate |
| SMILES | CC(=O)n1c(=O)c(F)cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OCCC#CCCCCc3ccccc3)O2)c1=O |
| InChI | InChI=1S/C25H30FN2O9P/c1-18(29)28-24(31)20(26)16-27(25(28)32)23-15-21(30)22(37-23)17-36-38(33,34)35-14-10-5-3-2-4-7-11-19-12-8-6-9-13-19/h6,8-9,12-13,16,21-23,30H,2,4,7,10-11,14-15,17H2,1H3,(H,33,34)/t21-,22+,23+/m0/s1 |
| InChIKey | FLYVPLXUWAWGAU-YTFSRNRJSA-N |
| XLogP | 2.40 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|