About 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine
2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine (PubChem CID 70466580) has the molecular formula C10H16BrNO
and a molecular weight of 246.15 g/mol. Its IUPAC name is 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine.
Molecular Properties
| Compound Name | 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine |
| PubChem CID | 70466580 |
| Molecular Formula | C10H16BrNO |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine |
| SMILES | CC1=CC(OCCN)C(C)(Br)C=C1 |
| InChI | InChI=1S/C10H16BrNO/c1-8-3-4-10(2,11)9(7-8)13-6-5-12/h3-4,7,9H,5-6,12H2,1-2H3 |
| InChIKey | GXYJJIMJJGVQPX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine?
The IUPAC name of 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine (CID 70466580) is 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine.
What is the SMILES notation for 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine?
The canonical SMILES for 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine is CC1=CC(OCCN)C(C)(Br)C=C1.
What is the InChIKey of 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine?
The InChIKey is GXYJJIMJJGVQPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16BrNO/c1-8-3-4-10(2,11)9(7-8)13-6-5-12/h3-4,7,9H,5-6,12H2,1-2H3.
What are the key properties of 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine?
2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine has a molecular weight of 246.15 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)oxyethanamine is sourced from PubChem (CID 70466580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).