About formonitrile;quinoxaline
formonitrile;quinoxaline (PubChem CID 70466882) has the molecular formula C9H7N3
and a molecular weight of 157.18 g/mol. Its IUPAC name is formonitrile;quinoxaline.
Molecular Properties
| Compound Name | formonitrile;quinoxaline |
| PubChem CID | 70466882 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | formonitrile;quinoxaline |
| SMILES | C#N.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H6N2.CHN/c1-2-4-8-7(3-1)9-5-6-10-8;1-2/h1-6H;1H |
| InChIKey | VNDQZYPMGPJSLO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formonitrile;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;quinoxaline?
The IUPAC name of formonitrile;quinoxaline (CID 70466882) is formonitrile;quinoxaline.
What is the SMILES notation for formonitrile;quinoxaline?
The canonical SMILES for formonitrile;quinoxaline is C#N.c1ccc2nccnc2c1.
What is the InChIKey of formonitrile;quinoxaline?
The InChIKey is VNDQZYPMGPJSLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.CHN/c1-2-4-8-7(3-1)9-5-6-10-8;1-2/h1-6H;1H.
What are the key properties of formonitrile;quinoxaline?
formonitrile;quinoxaline has a molecular weight of 157.18 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;quinoxaline is sourced from PubChem (CID 70466882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).