C19H27FO4 — CID 70467033
trans-[(5E)-4-methylhepta-1,5-dien-4-yl] (1R,3R)-3-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 70467033) has the molecular formula C19H27FO4 and a molecular weight of 338.42 g/mol. Its IUPAC name is trans-[(5E)-4-methylhepta-1,5-dien-4-yl] (1R,3R)-3-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-[(5E)-4-methylhepta-1,5-dien-4-yl] (1R,3R)-3-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 70467033 |
| Molecular Formula | C19H27FO4 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | trans-[(5E)-4-methylhepta-1,5-dien-4-yl] (1R,3R)-3-(3-ethoxy-2-fluoro-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C=CCC(C)(/C=C/C)OC(=O)[C@@H]1[C@H](C=C(F)C(=O)OCC)C1(C)C |
| InChI | InChI=1S/C19H27FO4/c1-7-10-19(6,11-8-2)24-17(22)15-13(18(15,4)5)12-14(20)16(21)23-9-3/h7-8,11-13,15H,1,9-10H2,2-6H3/b11-8+,14-12?/t13-,15-,19?/m0/s1 |
| InChIKey | CKELAWISIHEWDI-JBQBSXODSA-N |
| XLogP | 4.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|