C20H26O4 — CID 70467050
(1'R,3'S,5'S)-3'-[3-(2,4-dimethylphenyl)-1-hydroxyprop-1-enyl]spiro[1,3-dioxolane-2,6'-bicyclo[3.2.0]heptane]-2'-ol (PubChem CID 70467050) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1'R,3'S,5'S)-3'-[3-(2,4-dimethylphenyl)-1-hydroxyprop-1-enyl]spiro[1,3-dioxolane-2,6'-bicyclo[3.2.0]heptane]-2'-ol.
| Compound Name | (1'R,3'S,5'S)-3'-[3-(2,4-dimethylphenyl)-1-hydroxyprop-1-enyl]spiro[1,3-dioxolane-2,6'-bicyclo[3.2.0]heptane]-2'-ol |
|---|---|
| PubChem CID | 70467050 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1'R,3'S,5'S)-3'-[3-(2,4-dimethylphenyl)-1-hydroxyprop-1-enyl]spiro[1,3-dioxolane-2,6'-bicyclo[3.2.0]heptane]-2'-ol |
| SMILES | Cc1ccc(CC=C(O)[C@H]2C[C@H]3[C@@H](CC34OCCO4)C2O)c(C)c1 |
| InChI | InChI=1S/C20H26O4/c1-12-3-4-14(13(2)9-12)5-6-18(21)15-10-17-16(19(15)22)11-20(17)23-7-8-24-20/h3-4,6,9,15-17,19,21-22H,5,7-8,10-11H2,1-2H3/t15-,16-,17+,19?/m1/s1 |
| InChIKey | OQYNOYRPVFDLMX-VLFFPSDRSA-N |
| XLogP | 3.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|