About [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol
[4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol (PubChem CID 70467073) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol |
| PubChem CID | 70467073 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol |
| SMILES | OCC1(CO)COCN1 |
| InChI | InChI=1S/C5H11NO3/c7-1-5(2-8)3-9-4-6-5/h6-8H,1-4H2 |
| InChIKey | LFDCBZRDXPKKPM-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol?
The IUPAC name of [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol (CID 70467073) is [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol.
What is the SMILES notation for [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol?
The canonical SMILES for [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol is OCC1(CO)COCN1.
What is the InChIKey of [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol?
The InChIKey is LFDCBZRDXPKKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c7-1-5(2-8)3-9-4-6-5/h6-8H,1-4H2.
What are the key properties of [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol?
[4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol has a molecular weight of 133.15 g/mol, XLogP of -1.71, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)-1,3-oxazolidin-4-yl]methanol is sourced from PubChem (CID 70467073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).