C15H19BrO4 — CID 7046713
diethyl (2R,3R)-2-bromo-3-(4-methylphenyl)butanedioate (PubChem CID 7046713) has the molecular formula C15H19BrO4 and a molecular weight of 343.22 g/mol. Its IUPAC name is diethyl (2R,3R)-2-bromo-3-(4-methylphenyl)butanedioate.
| Compound Name | diethyl (2R,3R)-2-bromo-3-(4-methylphenyl)butanedioate |
|---|---|
| PubChem CID | 7046713 |
| Molecular Formula | C15H19BrO4 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | diethyl (2R,3R)-2-bromo-3-(4-methylphenyl)butanedioate |
| SMILES | CCOC(=O)[C@H](Br)[C@@H](C(=O)OCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19BrO4/c1-4-19-14(17)12(13(16)15(18)20-5-2)11-8-6-10(3)7-9-11/h6-9,12-13H,4-5H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | MNVZOGWIMOUWDL-QWHCGFSZSA-N |
| XLogP | 2.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|