C25H32N2O6 — CID 70467136
2-(butylcarbamoyl)benzoic acid;methyl 3-(butylcarbamoyl)benzoate (PubChem CID 70467136) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-(butylcarbamoyl)benzoic acid;methyl 3-(butylcarbamoyl)benzoate.
| Compound Name | 2-(butylcarbamoyl)benzoic acid;methyl 3-(butylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 70467136 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-(butylcarbamoyl)benzoic acid;methyl 3-(butylcarbamoyl)benzoate |
| SMILES | CCCCNC(=O)c1cccc(C(=O)OC)c1.CCCCNC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C13H17NO3.C12H15NO3/c1-3-4-8-14-12(15)10-6-5-7-11(9-10)13(16)17-2;1-2-3-8-13-11(14)9-6-4-5-7-10(9)12(15)16/h5-7,9H,3-4,8H2,1-2H3,(H,14,15);4-7H,2-3,8H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | FLTJVFJEQLQHCF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|