About 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine
4-(1-adamantylmethyl)hepta-1,6-dien-4-amine (PubChem CID 70467506) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine.
Molecular Properties
| Compound Name | 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine |
| PubChem CID | 70467506 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine |
| SMILES | C=CCC(N)(CC=C)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H29N/c1-3-5-18(19,6-4-2)13-17-10-14-7-15(11-17)9-16(8-14)12-17/h3-4,14-16H,1-2,5-13,19H2 |
| InChIKey | WQDOQKBSTCXBCC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine?
The IUPAC name of 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine (CID 70467506) is 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine.
What is the SMILES notation for 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine?
The canonical SMILES for 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine is C=CCC(N)(CC=C)CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine?
The InChIKey is WQDOQKBSTCXBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N/c1-3-5-18(19,6-4-2)13-17-10-14-7-15(11-17)9-16(8-14)12-17/h3-4,14-16H,1-2,5-13,19H2.
What are the key properties of 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine?
4-(1-adamantylmethyl)hepta-1,6-dien-4-amine has a molecular weight of 259.44 g/mol, XLogP of 4.44, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantylmethyl)hepta-1,6-dien-4-amine is sourced from PubChem (CID 70467506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).