About 2-(aminomethyl)-1,3-oxazol-5-amine
2-(aminomethyl)-1,3-oxazol-5-amine (PubChem CID 70467643) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 2-(aminomethyl)-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-1,3-oxazol-5-amine |
| PubChem CID | 70467643 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 2-(aminomethyl)-1,3-oxazol-5-amine |
| SMILES | NCc1ncc(N)o1 |
| InChI | InChI=1S/C4H7N3O/c5-1-4-7-2-3(6)8-4/h2H,1,5-6H2 |
| InChIKey | YIJNLBQWGVEKCF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-1,3-oxazol-5-amine?
The IUPAC name of 2-(aminomethyl)-1,3-oxazol-5-amine (CID 70467643) is 2-(aminomethyl)-1,3-oxazol-5-amine.
What is the SMILES notation for 2-(aminomethyl)-1,3-oxazol-5-amine?
The canonical SMILES for 2-(aminomethyl)-1,3-oxazol-5-amine is NCc1ncc(N)o1.
What is the InChIKey of 2-(aminomethyl)-1,3-oxazol-5-amine?
The InChIKey is YIJNLBQWGVEKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c5-1-4-7-2-3(6)8-4/h2H,1,5-6H2.
What are the key properties of 2-(aminomethyl)-1,3-oxazol-5-amine?
2-(aminomethyl)-1,3-oxazol-5-amine has a molecular weight of 113.12 g/mol, XLogP of -0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-1,3-oxazol-5-amine is sourced from PubChem (CID 70467643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).