C10H8N6O4 — CID 7046768
(3aR,6aR)-3,6-diamino-2,5-dinitro-1,4-dihydropentalene-3a,6a-dicarbonitrile (PubChem CID 7046768) has the molecular formula C10H8N6O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is (3aR,6aR)-3,6-diamino-2,5-dinitro-1,4-dihydropentalene-3a,6a-dicarbonitrile.
| Compound Name | (3aR,6aR)-3,6-diamino-2,5-dinitro-1,4-dihydropentalene-3a,6a-dicarbonitrile |
|---|---|
| PubChem CID | 7046768 |
| Molecular Formula | C10H8N6O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (3aR,6aR)-3,6-diamino-2,5-dinitro-1,4-dihydropentalene-3a,6a-dicarbonitrile |
| SMILES | N#C[C@]12CC([N+](=O)[O-])=C(N)[C@@]1(C#N)CC([N+](=O)[O-])=C2N |
| InChI | InChI=1S/C10H8N6O4/c11-3-9-1-5(15(17)18)7(13)10(9,4-12)2-6(8(9)14)16(19)20/h1-2,13-14H2/t9-,10-/m0/s1 |
| InChIKey | KOKNDQFAJTYOKR-UWVGGRQHSA-N |
| XLogP | -0.29 |
| TPSA | 185.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|