About N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride
N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride (PubChem CID 70467726) has the molecular formula C16H21Cl2N3O
and a molecular weight of 342.27 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride |
| PubChem CID | 70467726 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride |
| SMILES | CCc1ccc(Cl)c(CC)c1N(Cn1cccn1)C(C)=O.Cl |
| InChI | InChI=1S/C16H20ClN3O.ClH/c1-4-13-7-8-15(17)14(5-2)16(13)20(12(3)21)11-19-10-6-9-18-19;/h6-10H,4-5,11H2,1-3H3;1H |
| InChIKey | FIBMGXXXHZFUHC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride?
The IUPAC name of N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride (CID 70467726) is N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride.
What is the SMILES notation for N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride?
The canonical SMILES for N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride is CCc1ccc(Cl)c(CC)c1N(Cn1cccn1)C(C)=O.Cl.
What is the InChIKey of N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride?
The InChIKey is FIBMGXXXHZFUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN3O.ClH/c1-4-13-7-8-15(17)14(5-2)16(13)20(12(3)21)11-19-10-6-9-18-19;/h6-10H,4-5,11H2,1-3H3;1H.
What are the key properties of N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride?
N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride has a molecular weight of 342.27 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-2,6-diethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide;hydrochloride is sourced from PubChem (CID 70467726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).