C35H64N8 — CID 70468179
4-N,4-N-bis(prop-2-enyl)-2-N,2-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-6-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 70468179) has the molecular formula C35H64N8 and a molecular weight of 596.95 g/mol. Its IUPAC name is 4-N,4-N-bis(prop-2-enyl)-2-N,2-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-6-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,4-N-bis(prop-2-enyl)-2-N,2-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-6-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 70468179 |
| Molecular Formula | C35H64N8 |
| Molecular Weight | 596.95 g/mol |
| Exact Mass | 596.53 |
| IUPAC Name | 4-N,4-N-bis(prop-2-enyl)-2-N,2-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-6-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCN(CC=C)c1nc(NC(C)(C)CC(C)(C)C)nc(N(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C35H64N8/c1-16-18-42(19-17-2)28-36-27(39-35(14,15)24-30(3,4)5)37-29(38-28)43(25-20-31(6,7)40-32(8,9)21-25)26-22-33(10,11)41-34(12,13)23-26/h16-17,25-26,40-41H,1-2,18-24H2,3-15H3,(H,36,37,38,39) |
| InChIKey | AHAQPLCHOZSNNS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.95 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|