About N-butyl-6,7-dihydro-3H-inden-4-amine
N-butyl-6,7-dihydro-3H-inden-4-amine (PubChem CID 70468511) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is N-butyl-6,7-dihydro-3H-inden-4-amine.
Molecular Properties
| Compound Name | N-butyl-6,7-dihydro-3H-inden-4-amine |
| PubChem CID | 70468511 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-butyl-6,7-dihydro-3H-inden-4-amine |
| SMILES | CCCCNC1=CCCC2=C1CC=C2 |
| InChI | InChI=1S/C13H19N/c1-2-3-10-14-13-9-5-7-11-6-4-8-12(11)13/h4,6,9,14H,2-3,5,7-8,10H2,1H3 |
| InChIKey | FROWBYZYFJUYNU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6,7-dihydro-3H-inden-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6,7-dihydro-3H-inden-4-amine?
The IUPAC name of N-butyl-6,7-dihydro-3H-inden-4-amine (CID 70468511) is N-butyl-6,7-dihydro-3H-inden-4-amine.
What is the SMILES notation for N-butyl-6,7-dihydro-3H-inden-4-amine?
The canonical SMILES for N-butyl-6,7-dihydro-3H-inden-4-amine is CCCCNC1=CCCC2=C1CC=C2.
What is the InChIKey of N-butyl-6,7-dihydro-3H-inden-4-amine?
The InChIKey is FROWBYZYFJUYNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-2-3-10-14-13-9-5-7-11-6-4-8-12(11)13/h4,6,9,14H,2-3,5,7-8,10H2,1H3.
What are the key properties of N-butyl-6,7-dihydro-3H-inden-4-amine?
N-butyl-6,7-dihydro-3H-inden-4-amine has a molecular weight of 189.30 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6,7-dihydro-3H-inden-4-amine is sourced from PubChem (CID 70468511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).