About (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate
(7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate (PubChem CID 70468676) has the molecular formula C17H14O5
and a molecular weight of 298.29 g/mol. Its IUPAC name is (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate |
| PubChem CID | 70468676 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate |
| SMILES | Cc1cc(C(=O)c2ccccc2)c2c(c1)C(OC(=O)O)CO2 |
| InChI | InChI=1S/C17H14O5/c1-10-7-12-14(22-17(19)20)9-21-16(12)13(8-10)15(18)11-5-3-2-4-6-11/h2-8,14H,9H2,1H3,(H,19,20) |
| InChIKey | GFQNEKGHKQVXRN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate?
The IUPAC name of (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate (CID 70468676) is (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate.
What is the SMILES notation for (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate?
The canonical SMILES for (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate is Cc1cc(C(=O)c2ccccc2)c2c(c1)C(OC(=O)O)CO2.
What is the InChIKey of (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate?
The InChIKey is GFQNEKGHKQVXRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O5/c1-10-7-12-14(22-17(19)20)9-21-16(12)13(8-10)15(18)11-5-3-2-4-6-11/h2-8,14H,9H2,1H3,(H,19,20).
What are the key properties of (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate?
(7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate has a molecular weight of 298.29 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-benzoyl-5-methyl-2,3-dihydro-1-benzofuran-3-yl) hydrogen carbonate is sourced from PubChem (CID 70468676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).