C14H19N3 — CID 70468728
6-prop-2-enyl-7,8,9,9a,10,10a-hexahydro-4aH-pyrido[2,3-g]quinazoline (PubChem CID 70468728) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 6-prop-2-enyl-7,8,9,9a,10,10a-hexahydro-4aH-pyrido[2,3-g]quinazoline.
| Compound Name | 6-prop-2-enyl-7,8,9,9a,10,10a-hexahydro-4aH-pyrido[2,3-g]quinazoline |
|---|---|
| PubChem CID | 70468728 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 6-prop-2-enyl-7,8,9,9a,10,10a-hexahydro-4aH-pyrido[2,3-g]quinazoline |
| SMILES | C=CCN1CCCC2CC3N=CN=CC3C=C21 |
| InChI | InChI=1S/C14H19N3/c1-2-5-17-6-3-4-11-7-13-12(8-14(11)17)9-15-10-16-13/h2,8-13H,1,3-7H2 |
| InChIKey | VCUVEJWIHSBZKX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|