C21H30Cl3N3O6 — CID 70468782
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide (PubChem CID 70468782) has the molecular formula C21H30Cl3N3O6 and a molecular weight of 526.85 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 70468782 |
| Molecular Formula | C21H30Cl3N3O6 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n1ccnc1.OCCOCCOCCO |
| InChI | InChI=1S/C15H16Cl3N3O2.C6H14O4/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18;7-1-3-9-5-6-10-4-2-8/h3,5,8-10H,2,4,6-7H2,1H3;7-8H,1-6H2 |
| InChIKey | RKUFJHZLJQMVJC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|