About 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide
1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide (PubChem CID 70468836) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide.
Molecular Properties
| Compound Name | 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide |
| PubChem CID | 70468836 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide |
| SMILES | C[N+]1(C)C=NCC1.[OH-] |
| InChI | InChI=1S/C5H11N2.H2O/c1-7(2)4-3-6-5-7;/h5H,3-4H2,1-2H3;1H2/q+1;/p-1 |
| InChIKey | BVQGNPGPAAWQQY-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 42.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide?
The IUPAC name of 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide (CID 70468836) is 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide.
What is the SMILES notation for 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide?
The canonical SMILES for 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide is C[N+]1(C)C=NCC1.[OH-].
What is the InChIKey of 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide?
The InChIKey is BVQGNPGPAAWQQY-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H11N2.H2O/c1-7(2)4-3-6-5-7;/h5H,3-4H2,1-2H3;1H2/q+1;/p-1.
What are the key properties of 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide?
1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide has a molecular weight of 116.16 g/mol, XLogP of -0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-4,5-dihydroimidazol-1-ium hydroxide is sourced from PubChem (CID 70468836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).