C20H24Br4O8 — CID 70468986
3,4,5,6-tetrabromo-1,2-bis(2-hydroxy-3-prop-2-enoxypropyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 70468986) has the molecular formula C20H24Br4O8 and a molecular weight of 712.02 g/mol. Its IUPAC name is 3,4,5,6-tetrabromo-1,2-bis(2-hydroxy-3-prop-2-enoxypropyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4,5,6-tetrabromo-1,2-bis(2-hydroxy-3-prop-2-enoxypropyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70468986 |
| Molecular Formula | C20H24Br4O8 |
| Molecular Weight | 712.02 g/mol |
| Exact Mass | 707.82 |
| IUPAC Name | 3,4,5,6-tetrabromo-1,2-bis(2-hydroxy-3-prop-2-enoxypropyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | C=CCOCC(O)CC1(C(=O)O)C(Br)=C(Br)C(Br)=C(Br)C1(CC(O)COCC=C)C(=O)O |
| InChI | InChI=1S/C20H24Br4O8/c1-3-5-31-9-11(25)7-19(17(27)28)15(23)13(21)14(22)16(24)20(19,18(29)30)8-12(26)10-32-6-4-2/h3-4,11-12,25-26H,1-2,5-10H2,(H,27,28)(H,29,30) |
| InChIKey | CVMOAGBMJLZBMT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.02 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|